C7H6N2 — CID 152749055
4H-pyrrolo[2,3-b]pyridine (PubChem CID 152749055) has the molecular formula C7H6N2 and a molecular weight of 118.14 g/mol. Its IUPAC name is 4H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 152749055 |
| Molecular Formula | C7H6N2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | 4H-pyrrolo[2,3-b]pyridine |
| SMILES | C1=CN=C2N=CC=C2C1 |
| InChI | InChI=1S/C7H6N2/c1-2-6-3-5-9-7(6)8-4-1/h1,3-5H,2H2 |
| InChIKey | GACLCOXEPRMDPF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |