About 5H-pyrimido[4,5-b]indole
5H-pyrimido[4,5-b]indole (PubChem CID 141114367) has the molecular formula C10H7N3
and a molecular weight of 169.19 g/mol. Its IUPAC name is 5H-pyrimido[4,5-b]indole.
Molecular Properties
| Compound Name | 5H-pyrimido[4,5-b]indole |
| PubChem CID | 141114367 |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 5H-pyrimido[4,5-b]indole |
| SMILES | C1=CCC2=c3cncnc3=NC2=C1 |
| InChI | InChI=1S/C10H7N3/c1-2-4-9-7(3-1)8-5-11-6-12-10(8)13-9/h1-2,4-6H,3H2 |
| InChIKey | VKIBFLPBNBVTMM-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-pyrimido[4,5-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrimido[4,5-b]indole?
The IUPAC name of 5H-pyrimido[4,5-b]indole (CID 141114367) is 5H-pyrimido[4,5-b]indole.
What is the SMILES notation for 5H-pyrimido[4,5-b]indole?
The canonical SMILES for 5H-pyrimido[4,5-b]indole is C1=CCC2=c3cncnc3=NC2=C1.
What is the InChIKey of 5H-pyrimido[4,5-b]indole?
The InChIKey is VKIBFLPBNBVTMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3/c1-2-4-9-7(3-1)8-5-11-6-12-10(8)13-9/h1-2,4-6H,3H2.
What are the key properties of 5H-pyrimido[4,5-b]indole?
5H-pyrimido[4,5-b]indole has a molecular weight of 169.19 g/mol, XLogP of 0.10, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrimido[4,5-b]indole is sourced from PubChem (CID 141114367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).