C17H26N4 — CID 152753354
2-(3-aminocyclohexyl)-4-N,4-N-dimethyl-1H-quinoline-2,4-diamine (PubChem CID 152753354) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-(3-aminocyclohexyl)-4-N,4-N-dimethyl-1H-quinoline-2,4-diamine.
| Compound Name | 2-(3-aminocyclohexyl)-4-N,4-N-dimethyl-1H-quinoline-2,4-diamine |
|---|---|
| PubChem CID | 152753354 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 2-(3-aminocyclohexyl)-4-N,4-N-dimethyl-1H-quinoline-2,4-diamine |
| SMILES | CN(C)C1=CC(N)(C2CCCC(N)C2)Nc2ccccc21 |
| InChI | InChI=1S/C17H26N4/c1-21(2)16-11-17(19,12-6-5-7-13(18)10-12)20-15-9-4-3-8-14(15)16/h3-4,8-9,11-13,20H,5-7,10,18-19H2,1-2H3 |
| InChIKey | TUDITSXAWREPPJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |