C25H24FN5O2 — CID 152753790
4-[ethyl-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]-2-(3-fluorophenyl)benzohydrazide (PubChem CID 152753790) has the molecular formula C25H24FN5O2 and a molecular weight of 445.50 g/mol. Its IUPAC name is 4-[ethyl-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]-2-(3-fluorophenyl)benzohydrazide.
| Compound Name | 4-[ethyl-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]-2-(3-fluorophenyl)benzohydrazide |
|---|---|
| PubChem CID | 152753790 |
| Molecular Formula | C25H24FN5O2 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 4-[ethyl-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]-2-(3-fluorophenyl)benzohydrazide |
| SMILES | CCN(Cc1ccc2nc(C)[nH]c(=O)c2c1)c1ccc(C(=O)NN)c(-c2cccc(F)c2)c1 |
| InChI | InChI=1S/C25H24FN5O2/c1-3-31(14-16-7-10-23-22(11-16)24(32)29-15(2)28-23)19-8-9-20(25(33)30-27)21(13-19)17-5-4-6-18(26)12-17/h4-13H,3,14,27H2,1-2H3,(H,30,33)(H,28,29,32) |
| InChIKey | RDCUYJQHLHUTBY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|