C15H22O5 — CID 15276056
(1S,2S,6S,11R,14R)-14-methoxy-11-methyl-3,15-dioxatricyclo[9.4.0.02,6]pentadecane-4,9-dione (PubChem CID 15276056) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (1S,2S,6S,11R,14R)-14-methoxy-11-methyl-3,15-dioxatricyclo[9.4.0.02,6]pentadecane-4,9-dione.
| Compound Name | (1S,2S,6S,11R,14R)-14-methoxy-11-methyl-3,15-dioxatricyclo[9.4.0.02,6]pentadecane-4,9-dione |
|---|---|
| PubChem CID | 15276056 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (1S,2S,6S,11R,14R)-14-methoxy-11-methyl-3,15-dioxatricyclo[9.4.0.02,6]pentadecane-4,9-dione |
| SMILES | CO[C@H]1CC[C@]2(C)CC(=O)CC[C@H]3CC(=O)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C15H22O5/c1-15-6-5-12(18-2)20-14(15)13-9(7-11(17)19-13)3-4-10(16)8-15/h9,12-14H,3-8H2,1-2H3/t9-,12+,13-,14+,15+/m0/s1 |
| InChIKey | YPPZIKYIYCFVLB-KGKICYMHSA-N |
| XLogP | 1.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |