C21H38O5Si — CID 99961173
(1R,2S,6S,9R,11R,14R)-9-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-11-methyl-3,15-dioxatricyclo[9.4.0.02,6]pentadecan-4-one (PubChem CID 99961173) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is (1R,2S,6S,9R,11R,14R)-9-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-11-methyl-3,15-dioxatricyclo[9.4.0.02,6]pentadecan-4-one.
| Compound Name | (1R,2S,6S,9R,11R,14R)-9-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-11-methyl-3,15-dioxatricyclo[9.4.0.02,6]pentadecan-4-one |
|---|---|
| PubChem CID | 99961173 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (1R,2S,6S,9R,11R,14R)-9-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-11-methyl-3,15-dioxatricyclo[9.4.0.02,6]pentadecan-4-one |
| SMILES | CO[C@H]1CC[C@]2(C)C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@H]3CC(=O)O[C@@H]3[C@@H]2O1 |
| InChI | InChI=1S/C21H38O5Si/c1-20(2,3)27(6,7)26-15-9-8-14-12-16(22)24-18(14)19-21(4,13-15)11-10-17(23-5)25-19/h14-15,17-19H,8-13H2,1-7H3/t14-,15+,17+,18-,19-,21+/m0/s1 |
| InChIKey | IHLRZFFYJCOWIA-ICVGXQTJSA-N |
| XLogP | 4.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|