C34H41F2N2O9P — CID 152761665
methyl 2-[4-[[(2S)-2-amino-2-[[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]-3-oxo-3-phenylmethoxypropanoyl]amino]butoxy]benzoate (PubChem CID 152761665) has the molecular formula C34H41F2N2O9P and a molecular weight of 690.68 g/mol. Its IUPAC name is methyl 2-[4-[[(2S)-2-amino-2-[[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]-3-oxo-3-phenylmethoxypropanoyl]amino]butoxy]benzoate.
| Compound Name | methyl 2-[4-[[(2S)-2-amino-2-[[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]-3-oxo-3-phenylmethoxypropanoyl]amino]butoxy]benzoate |
|---|---|
| PubChem CID | 152761665 |
| Molecular Formula | C34H41F2N2O9P |
| Molecular Weight | 690.68 g/mol |
| Exact Mass | 690.25 |
| IUPAC Name | methyl 2-[4-[[(2S)-2-amino-2-[[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]-3-oxo-3-phenylmethoxypropanoyl]amino]butoxy]benzoate |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1ccc(C[C@](N)(C(=O)NCCCCOc2ccccc2C(=O)OC)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H41F2N2O9P/c1-4-46-48(42,47-5-2)34(35,36)27-19-17-25(18-20-27)23-33(37,32(41)45-24-26-13-7-6-8-14-26)31(40)38-21-11-12-22-44-29-16-10-9-15-28(29)30(39)43-3/h6-10,13-20H,4-5,11-12,21-24,37H2,1-3H3,(H,38,40)/t33-/m0/s1 |
| InChIKey | FMGJSVPOMIABLP-XIFFEERXSA-N |
| XLogP | 5.75 |
| TPSA | 152.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|