C29H28F2NO7P — CID 155701388
dibenzyl 5-[diethoxyphosphoryl(difluoro)methyl]indole-1,2-dicarboxylate (PubChem CID 155701388) has the molecular formula C29H28F2NO7P and a molecular weight of 571.51 g/mol. Its IUPAC name is dibenzyl 5-[diethoxyphosphoryl(difluoro)methyl]indole-1,2-dicarboxylate.
| Compound Name | dibenzyl 5-[diethoxyphosphoryl(difluoro)methyl]indole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155701388 |
| Molecular Formula | C29H28F2NO7P |
| Molecular Weight | 571.51 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | dibenzyl 5-[diethoxyphosphoryl(difluoro)methyl]indole-1,2-dicarboxylate |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1ccc2c(c1)cc(C(=O)OCc1ccccc1)n2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H28F2NO7P/c1-3-38-40(35,39-4-2)29(30,31)24-15-16-25-23(17-24)18-26(27(33)36-19-21-11-7-5-8-12-21)32(25)28(34)37-20-22-13-9-6-10-14-22/h5-18H,3-4,19-20H2,1-2H3 |
| InChIKey | KAYCRBPDMHMZGB-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.51 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|