C36H36F2NO7P — CID 91519216
[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl (2R,3S)-3-benzyl-6-oxo-2,3-diphenylmorpholine-4-carboxylate (PubChem CID 91519216) has the molecular formula C36H36F2NO7P and a molecular weight of 663.65 g/mol. Its IUPAC name is [4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl (2R,3S)-3-benzyl-6-oxo-2,3-diphenylmorpholine-4-carboxylate.
| Compound Name | [4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl (2R,3S)-3-benzyl-6-oxo-2,3-diphenylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 91519216 |
| Molecular Formula | C36H36F2NO7P |
| Molecular Weight | 663.65 g/mol |
| Exact Mass | 663.22 |
| IUPAC Name | [4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl (2R,3S)-3-benzyl-6-oxo-2,3-diphenylmorpholine-4-carboxylate |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1ccc(COC(=O)N2CC(=O)O[C@H](c3ccccc3)[C@]2(Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H36F2NO7P/c1-3-44-47(42,45-4-2)36(37,38)31-22-20-28(21-23-31)26-43-34(41)39-25-32(40)46-33(29-16-10-6-11-17-29)35(39,30-18-12-7-13-19-30)24-27-14-8-5-9-15-27/h5-23,33H,3-4,24-26H2,1-2H3/t33-,35+/m1/s1 |
| InChIKey | LYAJIPDUVIREFO-OQBISYOISA-N |
| XLogP | 8.38 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.65 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|