C16H15N3 — CID 152764541
3-pyridin-4-yl-3,3a,4,5-tetrahydro-2H-benzo[g]indazole (PubChem CID 152764541) has the molecular formula C16H15N3 and a molecular weight of 249.32 g/mol. Its IUPAC name is 3-pyridin-4-yl-3,3a,4,5-tetrahydro-2H-benzo[g]indazole.
| Compound Name | 3-pyridin-4-yl-3,3a,4,5-tetrahydro-2H-benzo[g]indazole |
|---|---|
| PubChem CID | 152764541 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 3-pyridin-4-yl-3,3a,4,5-tetrahydro-2H-benzo[g]indazole |
| SMILES | c1ccc2c(c1)CCC1C2=NNC1c1ccncc1 |
| InChI | InChI=1S/C16H15N3/c1-2-4-13-11(3-1)5-6-14-15(18-19-16(13)14)12-7-9-17-10-8-12/h1-4,7-10,14-15,18H,5-6H2 |
| InChIKey | XBEZWURBWNTFOX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |