C12H14N4O3 — CID 152771788
4,5-diamino-2-(2,6-dimethoxyphenyl)-1H-pyrimidin-6-one (PubChem CID 152771788) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 4,5-diamino-2-(2,6-dimethoxyphenyl)-1H-pyrimidin-6-one.
| Compound Name | 4,5-diamino-2-(2,6-dimethoxyphenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 152771788 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4,5-diamino-2-(2,6-dimethoxyphenyl)-1H-pyrimidin-6-one |
| SMILES | COc1cccc(OC)c1-c1nc(N)c(N)c(=O)[nH]1 |
| InChI | InChI=1S/C12H14N4O3/c1-18-6-4-3-5-7(19-2)8(6)11-15-10(14)9(13)12(17)16-11/h3-5H,13H2,1-2H3,(H3,14,15,16,17) |
| InChIKey | GIZSMSBFOITXJE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |