C15H18N4O2 — CID 154661702
4,5-diamino-2-(4-cyclopropyl-2-ethoxyphenyl)-1H-pyrimidin-6-one (PubChem CID 154661702) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 4,5-diamino-2-(4-cyclopropyl-2-ethoxyphenyl)-1H-pyrimidin-6-one.
| Compound Name | 4,5-diamino-2-(4-cyclopropyl-2-ethoxyphenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 154661702 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4,5-diamino-2-(4-cyclopropyl-2-ethoxyphenyl)-1H-pyrimidin-6-one |
| SMILES | CCOc1cc(C2CC2)ccc1-c1nc(N)c(N)c(=O)[nH]1 |
| InChI | InChI=1S/C15H18N4O2/c1-2-21-11-7-9(8-3-4-8)5-6-10(11)14-18-13(17)12(16)15(20)19-14/h5-8H,2-4,16H2,1H3,(H3,17,18,19,20) |
| InChIKey | LWUDAZKLVWDNGO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |