C12H22N2O2S — CID 152780338
4-propyl-4-(propylamino)cyclohexa-1,5-diene-1-sulfonamide (PubChem CID 152780338) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 4-propyl-4-(propylamino)cyclohexa-1,5-diene-1-sulfonamide.
| Compound Name | 4-propyl-4-(propylamino)cyclohexa-1,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 152780338 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 4-propyl-4-(propylamino)cyclohexa-1,5-diene-1-sulfonamide |
| SMILES | CCCNC1(CCC)C=CC(S(N)(=O)=O)=CC1 |
| InChI | InChI=1S/C12H22N2O2S/c1-3-7-12(14-10-4-2)8-5-11(6-9-12)17(13,15)16/h5-6,8,14H,3-4,7,9-10H2,1-2H3,(H2,13,15,16) |
| InChIKey | NTXBIOSPILDJBK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |