C15H28N2O2S — CID 163862920
(4S)-N,4-diethyl-N-[2-(propylamino)ethyl]cyclohexa-1,5-diene-1-sulfonamide (PubChem CID 163862920) has the molecular formula C15H28N2O2S and a molecular weight of 300.47 g/mol. Its IUPAC name is (4S)-N,4-diethyl-N-[2-(propylamino)ethyl]cyclohexa-1,5-diene-1-sulfonamide.
| Compound Name | (4S)-N,4-diethyl-N-[2-(propylamino)ethyl]cyclohexa-1,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 163862920 |
| Molecular Formula | C15H28N2O2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (4S)-N,4-diethyl-N-[2-(propylamino)ethyl]cyclohexa-1,5-diene-1-sulfonamide |
| SMILES | CCCNCCN(CC)S(=O)(=O)C1=CC[C@H](CC)C=C1 |
| InChI | InChI=1S/C15H28N2O2S/c1-4-11-16-12-13-17(6-3)20(18,19)15-9-7-14(5-2)8-10-15/h7,9-10,14,16H,4-6,8,11-13H2,1-3H3/t14-/m1/s1 |
| InChIKey | PECUABXLTCZGGW-CQSZACIVSA-N |
| XLogP | 2.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|