C9H16N2O2S — CID 154255539
4-amino-4-propylcyclohexa-1,5-diene-1-sulfonamide (PubChem CID 154255539) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 4-amino-4-propylcyclohexa-1,5-diene-1-sulfonamide.
| Compound Name | 4-amino-4-propylcyclohexa-1,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 154255539 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 4-amino-4-propylcyclohexa-1,5-diene-1-sulfonamide |
| SMILES | CCCC1(N)C=CC(S(N)(=O)=O)=CC1 |
| InChI | InChI=1S/C9H16N2O2S/c1-2-5-9(10)6-3-8(4-7-9)14(11,12)13/h3-4,6H,2,5,7,10H2,1H3,(H2,11,12,13) |
| InChIKey | LNAGCNJCRUWXPW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |