C21H34N2O5Si — CID 152781228
[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] 4-tert-butylsilyloxypiperidine-1-carboxylate (PubChem CID 152781228) has the molecular formula C21H34N2O5Si and a molecular weight of 422.60 g/mol. Its IUPAC name is [4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] 4-tert-butylsilyloxypiperidine-1-carboxylate.
| Compound Name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] 4-tert-butylsilyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 152781228 |
| Molecular Formula | C21H34N2O5Si |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] 4-tert-butylsilyloxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(OC(=O)N2CCC(O[SiH2]C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H34N2O5Si/c1-20(2,3)27-18(24)22-15-7-9-16(10-8-15)26-19(25)23-13-11-17(12-14-23)28-29-21(4,5)6/h7-10,17H,11-14,29H2,1-6H3,(H,22,24) |
| InChIKey | GWOWGHYRMMSMPY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|