C16H11BrO — CID 152782774
5-bromo-4a,10a-dihydronaphtho[1,2-b][1]benzofuran (PubChem CID 152782774) has the molecular formula C16H11BrO and a molecular weight of 299.17 g/mol. Its IUPAC name is 5-bromo-4a,10a-dihydronaphtho[1,2-b][1]benzofuran.
| Compound Name | 5-bromo-4a,10a-dihydronaphtho[1,2-b][1]benzofuran |
|---|---|
| PubChem CID | 152782774 |
| Molecular Formula | C16H11BrO |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 5-bromo-4a,10a-dihydronaphtho[1,2-b][1]benzofuran |
| SMILES | BrC1=CC2=C3C=CC=CC3OC2=C2C=CC=CC12 |
| InChI | InChI=1S/C16H11BrO/c17-14-9-13-11-6-3-4-8-15(11)18-16(13)12-7-2-1-5-10(12)14/h1-10,15H |
| InChIKey | JLZSYUKGNBQAAA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |