C54H54N2 — CID 152787696
9-(3,5-dimethylphenyl)-9-methyl-2-N,7-N-bis(4-methylphenyl)-2-N,7-N-bis(2,4,6-trimethylphenyl)fluorene-2,7-diamine (PubChem CID 152787696) has the molecular formula C54H54N2 and a molecular weight of 731.04 g/mol. Its IUPAC name is 9-(3,5-dimethylphenyl)-9-methyl-2-N,7-N-bis(4-methylphenyl)-2-N,7-N-bis(2,4,6-trimethylphenyl)fluorene-2,7-diamine.
| Compound Name | 9-(3,5-dimethylphenyl)-9-methyl-2-N,7-N-bis(4-methylphenyl)-2-N,7-N-bis(2,4,6-trimethylphenyl)fluorene-2,7-diamine |
|---|---|
| PubChem CID | 152787696 |
| Molecular Formula | C54H54N2 |
| Molecular Weight | 731.04 g/mol |
| Exact Mass | 730.43 |
| IUPAC Name | 9-(3,5-dimethylphenyl)-9-methyl-2-N,7-N-bis(4-methylphenyl)-2-N,7-N-bis(2,4,6-trimethylphenyl)fluorene-2,7-diamine |
| SMILES | Cc1ccc(N(c2ccc3c(c2)C(C)(c2cc(C)cc(C)c2)c2cc(N(c4ccc(C)cc4)c4c(C)cc(C)cc4C)ccc2-3)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C54H54N2/c1-33-12-16-44(17-13-33)55(52-39(7)25-37(5)26-40(52)8)46-20-22-48-49-23-21-47(32-51(49)54(11,50(48)31-46)43-29-35(3)24-36(4)30-43)56(45-18-14-34(2)15-19-45)53-41(9)27-38(6)28-42(53)10/h12-32H,1-11H3 |
| InChIKey | RZDOCKJZJAKMBK-UHFFFAOYSA-N |
| XLogP | 15.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.04 |
| LogP ≤ 5 | 15.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |