C23H17F2NO3 — CID 15278891
[4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl] acetate (PubChem CID 15278891) has the molecular formula C23H17F2NO3 and a molecular weight of 393.39 g/mol. Its IUPAC name is [4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl] acetate.
| Compound Name | [4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl] acetate |
|---|---|
| PubChem CID | 15278891 |
| Molecular Formula | C23H17F2NO3 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2ccc(C3COC(c4c(F)cccc4F)=N3)cc2)cc1 |
| InChI | InChI=1S/C23H17F2NO3/c1-14(27)29-18-11-9-16(10-12-18)15-5-7-17(8-6-15)21-13-28-23(26-21)22-19(24)3-2-4-20(22)25/h2-12,21H,13H2,1H3 |
| InChIKey | GOFAUCGBKDLWII-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|