C13H25NO7P+ — CID 152818284
dimethyl-[2-(4-oxo-4-prop-2-ynoxybutoxy)ethyl]-(2-phosphonooxyethyl)azanium (PubChem CID 152818284) has the molecular formula C13H25NO7P+ and a molecular weight of 338.32 g/mol. Its IUPAC name is dimethyl-[2-(4-oxo-4-prop-2-ynoxybutoxy)ethyl]-(2-phosphonooxyethyl)azanium.
| Compound Name | dimethyl-[2-(4-oxo-4-prop-2-ynoxybutoxy)ethyl]-(2-phosphonooxyethyl)azanium |
|---|---|
| PubChem CID | 152818284 |
| Molecular Formula | C13H25NO7P+ |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | dimethyl-[2-(4-oxo-4-prop-2-ynoxybutoxy)ethyl]-(2-phosphonooxyethyl)azanium |
| SMILES | C#CCOC(=O)CCCOCC[N+](C)(C)CCOP(=O)(O)O |
| InChI | InChI=1S/C13H24NO7P/c1-4-9-20-13(15)6-5-10-19-11-7-14(2,3)8-12-21-22(16,17)18/h1H,5-12H2,2-3H3,(H-,16,17,18)/p+1 |
| InChIKey | SSZUWTVILIHBCL-UHFFFAOYSA-O |
| XLogP | 0.15 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|