C21H32N2O4 — CID 152838956
tert-butyl 4-[1-(4-carbamoyl-2-methylphenyl)-2-methoxyethyl]piperidine-1-carboxylate (PubChem CID 152838956) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is tert-butyl 4-[1-(4-carbamoyl-2-methylphenyl)-2-methoxyethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(4-carbamoyl-2-methylphenyl)-2-methoxyethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 152838956 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | tert-butyl 4-[1-(4-carbamoyl-2-methylphenyl)-2-methoxyethyl]piperidine-1-carboxylate |
| SMILES | COCC(c1ccc(C(N)=O)cc1C)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H32N2O4/c1-14-12-16(19(22)24)6-7-17(14)18(13-26-5)15-8-10-23(11-9-15)20(25)27-21(2,3)4/h6-7,12,15,18H,8-11,13H2,1-5H3,(H2,22,24) |
| InChIKey | SYGPGQSUMYMBHF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |