C34H36N2O3S — CID 15288048
ethyl 2-[1-[(4-tert-butylphenyl)methyl]-2-methyl-5-[(2-phenyl-1,3-thiazol-4-yl)methoxy]indol-3-yl]acetate (PubChem CID 15288048) has the molecular formula C34H36N2O3S and a molecular weight of 552.74 g/mol. Its IUPAC name is ethyl 2-[1-[(4-tert-butylphenyl)methyl]-2-methyl-5-[(2-phenyl-1,3-thiazol-4-yl)methoxy]indol-3-yl]acetate.
| Compound Name | ethyl 2-[1-[(4-tert-butylphenyl)methyl]-2-methyl-5-[(2-phenyl-1,3-thiazol-4-yl)methoxy]indol-3-yl]acetate |
|---|---|
| PubChem CID | 15288048 |
| Molecular Formula | C34H36N2O3S |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | ethyl 2-[1-[(4-tert-butylphenyl)methyl]-2-methyl-5-[(2-phenyl-1,3-thiazol-4-yl)methoxy]indol-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c(C)n(Cc2ccc(C(C)(C)C)cc2)c2ccc(OCc3csc(-c4ccccc4)n3)cc12 |
| InChI | InChI=1S/C34H36N2O3S/c1-6-38-32(37)19-29-23(2)36(20-24-12-14-26(15-13-24)34(3,4)5)31-17-16-28(18-30(29)31)39-21-27-22-40-33(35-27)25-10-8-7-9-11-25/h7-18,22H,6,19-21H2,1-5H3 |
| InChIKey | FPBLLMXUIJAEMS-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|