C30H29F2NOS — CID 15288255
4-[bis(4-fluorophenyl)methyl]-1-[(3-methyl-5-phenylthiophen-2-yl)oxymethyl]piperidine (PubChem CID 15288255) has the molecular formula C30H29F2NOS and a molecular weight of 489.63 g/mol. Its IUPAC name is 4-[bis(4-fluorophenyl)methyl]-1-[(3-methyl-5-phenylthiophen-2-yl)oxymethyl]piperidine.
| Compound Name | 4-[bis(4-fluorophenyl)methyl]-1-[(3-methyl-5-phenylthiophen-2-yl)oxymethyl]piperidine |
|---|---|
| PubChem CID | 15288255 |
| Molecular Formula | C30H29F2NOS |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 4-[bis(4-fluorophenyl)methyl]-1-[(3-methyl-5-phenylthiophen-2-yl)oxymethyl]piperidine |
| SMILES | Cc1cc(-c2ccccc2)sc1OCN1CCC(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C30H29F2NOS/c1-21-19-28(22-5-3-2-4-6-22)35-30(21)34-20-33-17-15-25(16-18-33)29(23-7-11-26(31)12-8-23)24-9-13-27(32)14-10-24/h2-14,19,25,29H,15-18,20H2,1H3 |
| InChIKey | WAPWAVVYACIRTQ-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |