C17H20N4O2 — CID 152883392
[4-[(6-amino-3-pyridinyl)methyl]piperazin-1-yl] benzoate (PubChem CID 152883392) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is [4-[(6-amino-3-pyridinyl)methyl]piperazin-1-yl] benzoate.
| Compound Name | [4-[(6-amino-3-pyridinyl)methyl]piperazin-1-yl] benzoate |
|---|---|
| PubChem CID | 152883392 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [4-[(6-amino-3-pyridinyl)methyl]piperazin-1-yl] benzoate |
| SMILES | Nc1ccc(CN2CCN(OC(=O)c3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C17H20N4O2/c18-16-7-6-14(12-19-16)13-20-8-10-21(11-9-20)23-17(22)15-4-2-1-3-5-15/h1-7,12H,8-11,13H2,(H2,18,19) |
| InChIKey | UBXSOCQRLNTHGU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |