C12H11NO — CID 152888899
4,4a-dihydrodibenzofuran-3-amine (PubChem CID 152888899) has the molecular formula C12H11NO and a molecular weight of 185.23 g/mol. Its IUPAC name is 4,4a-dihydrodibenzofuran-3-amine.
| Compound Name | 4,4a-dihydrodibenzofuran-3-amine |
|---|---|
| PubChem CID | 152888899 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 4,4a-dihydrodibenzofuran-3-amine |
| SMILES | NC1=CC=C2c3ccccc3OC2C1 |
| InChI | InChI=1S/C12H11NO/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-6,12H,7,13H2 |
| InChIKey | UDBCHLRKVTUJND-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |