C21H16ClFN2O — CID 152930433
1-[3-[2-chloro-5-[(3-fluorophenyl)methyl]pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 152930433) has the molecular formula C21H16ClFN2O and a molecular weight of 366.82 g/mol. Its IUPAC name is 1-[3-[2-chloro-5-[(3-fluorophenyl)methyl]pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[2-chloro-5-[(3-fluorophenyl)methyl]pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 152930433 |
| Molecular Formula | C21H16ClFN2O |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-[3-[2-chloro-5-[(3-fluorophenyl)methyl]pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cccc(-c2nc(Cl)ncc2Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C21H16ClFN2O/c1-2-19(26)12-15-5-3-7-16(9-15)20-17(13-24-21(22)25-20)10-14-6-4-8-18(23)11-14/h2-9,11,13H,1,10,12H2 |
| InChIKey | UKWAGEPCQACUSD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|