C33H34N2O9 — CID 152940275
ethyl 6-amino-2-[[1,1-bis(4-acetyloxyphenyl)-3-oxo-2-benzofuran-5-carbonyl]amino]hexanoate (PubChem CID 152940275) has the molecular formula C33H34N2O9 and a molecular weight of 602.64 g/mol. Its IUPAC name is ethyl 6-amino-2-[[1,1-bis(4-acetyloxyphenyl)-3-oxo-2-benzofuran-5-carbonyl]amino]hexanoate.
| Compound Name | ethyl 6-amino-2-[[1,1-bis(4-acetyloxyphenyl)-3-oxo-2-benzofuran-5-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 152940275 |
| Molecular Formula | C33H34N2O9 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | ethyl 6-amino-2-[[1,1-bis(4-acetyloxyphenyl)-3-oxo-2-benzofuran-5-carbonyl]amino]hexanoate |
| SMILES | CCOC(=O)C(CCCCN)NC(=O)c1ccc2c(c1)C(=O)OC2(c1ccc(OC(C)=O)cc1)c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C33H34N2O9/c1-4-41-32(40)29(7-5-6-18-34)35-30(38)22-8-17-28-27(19-22)31(39)44-33(28,23-9-13-25(14-10-23)42-20(2)36)24-11-15-26(16-12-24)43-21(3)37/h8-17,19,29H,4-7,18,34H2,1-3H3,(H,35,38) |
| InChIKey | UMRBNESUAJXRDG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|