C21H21IN2O — CID 15294055
N-butan-2-yl-1-(2-iodophenyl)-N-methylisoquinoline-3-carboxamide (PubChem CID 15294055) has the molecular formula C21H21IN2O and a molecular weight of 444.32 g/mol. Its IUPAC name is N-butan-2-yl-1-(2-iodophenyl)-N-methylisoquinoline-3-carboxamide.
| Compound Name | N-butan-2-yl-1-(2-iodophenyl)-N-methylisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 15294055 |
| Molecular Formula | C21H21IN2O |
| Molecular Weight | 444.32 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | N-butan-2-yl-1-(2-iodophenyl)-N-methylisoquinoline-3-carboxamide |
| SMILES | CCC(C)N(C)C(=O)c1cc2ccccc2c(-c2ccccc2I)n1 |
| InChI | InChI=1S/C21H21IN2O/c1-4-14(2)24(3)21(25)19-13-15-9-5-6-10-16(15)20(23-19)17-11-7-8-12-18(17)22/h5-14H,4H2,1-3H3 |
| InChIKey | PYUYMBOKENEYDV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.32 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|