C26H22F6N4O — CID 15295112
2-[(2-aminophenyl)methyl]-4-benzyl-5-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-1,2,4-triazol-3-one (PubChem CID 15295112) has the molecular formula C26H22F6N4O and a molecular weight of 520.48 g/mol. Its IUPAC name is 2-[(2-aminophenyl)methyl]-4-benzyl-5-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-1,2,4-triazol-3-one.
| Compound Name | 2-[(2-aminophenyl)methyl]-4-benzyl-5-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 15295112 |
| Molecular Formula | C26H22F6N4O |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 2-[(2-aminophenyl)methyl]-4-benzyl-5-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-1,2,4-triazol-3-one |
| SMILES | Nc1ccccc1Cn1nc(CCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C26H22F6N4O/c27-25(28,29)20-12-18(13-21(14-20)26(30,31)32)10-11-23-34-36(16-19-8-4-5-9-22(19)33)24(37)35(23)15-17-6-2-1-3-7-17/h1-9,12-14H,10-11,15-16,33H2 |
| InChIKey | VAJANUQHQJVMSJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|