C22H19F6N3O — CID 19707308
4-benzyl-5-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-prop-2-enyl-1,2,4-triazol-3-one (PubChem CID 19707308) has the molecular formula C22H19F6N3O and a molecular weight of 455.40 g/mol. Its IUPAC name is 4-benzyl-5-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-prop-2-enyl-1,2,4-triazol-3-one.
| Compound Name | 4-benzyl-5-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-prop-2-enyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 19707308 |
| Molecular Formula | C22H19F6N3O |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 4-benzyl-5-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-prop-2-enyl-1,2,4-triazol-3-one |
| SMILES | C=CCn1nc(CCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C22H19F6N3O/c1-2-10-31-20(32)30(14-15-6-4-3-5-7-15)19(29-31)9-8-16-11-17(21(23,24)25)13-18(12-16)22(26,27)28/h2-7,11-13H,1,8-10,14H2 |
| InChIKey | JDGGVPYLAZNIHC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|