C26H23F6N4O+ — CID 54491199
4-[(3-aminophenyl)methyl]-4-benzyl-3-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-1H-1,2,4-triazol-4-ium-5-one (PubChem CID 54491199) has the molecular formula C26H23F6N4O+ and a molecular weight of 521.49 g/mol. Its IUPAC name is 4-[(3-aminophenyl)methyl]-4-benzyl-3-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-1H-1,2,4-triazol-4-ium-5-one.
| Compound Name | 4-[(3-aminophenyl)methyl]-4-benzyl-3-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-1H-1,2,4-triazol-4-ium-5-one |
|---|---|
| PubChem CID | 54491199 |
| Molecular Formula | C26H23F6N4O+ |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 4-[(3-aminophenyl)methyl]-4-benzyl-3-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-1H-1,2,4-triazol-4-ium-5-one |
| SMILES | Nc1cccc(C[N+]2(Cc3ccccc3)C(=O)NN=C2CCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C26H22F6N4O/c27-25(28,29)20-11-18(12-21(14-20)26(30,31)32)9-10-23-34-35-24(37)36(23,15-17-5-2-1-3-6-17)16-19-7-4-8-22(33)13-19/h1-8,11-14H,9-10,15-16,33H2/p+1 |
| InChIKey | VPXCCRQPGPGGFQ-UHFFFAOYSA-O |
| XLogP | 6.49 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|