C26H21NO4S2 — CID 152965361
9-(4-hydroxyphenyl)-14-phenyl-3,7-dithia-14-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 152965361) has the molecular formula C26H21NO4S2 and a molecular weight of 475.59 g/mol. Its IUPAC name is 9-(4-hydroxyphenyl)-14-phenyl-3,7-dithia-14-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | 9-(4-hydroxyphenyl)-14-phenyl-3,7-dithia-14-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 152965361 |
| Molecular Formula | C26H21NO4S2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 9-(4-hydroxyphenyl)-14-phenyl-3,7-dithia-14-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | O=C1CC2=C(S1)C(c1ccc(O)cc1)C1C3CC(C1S2)C1C(=O)N(c2ccccc2)C(=O)C31 |
| InChI | InChI=1S/C26H21NO4S2/c28-14-8-6-12(7-9-14)19-20-15-10-16(23(20)32-17-11-18(29)33-24(17)19)22-21(15)25(30)27(26(22)31)13-4-2-1-3-5-13/h1-9,15-16,19-23,28H,10-11H2 |
| InChIKey | URKDZRCHKGYFRY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|