C20H35FO4Si+2 — CID 152982056
[1-[5-(3-ethoxy-3-oxo-2-propan-2-yloxypropyl)-2-fluorophenyl]-2-methyl-1-oxoniopropan-2-yl]-dimethylsilanylium (PubChem CID 152982056) has the molecular formula C20H35FO4Si+2 and a molecular weight of 386.58 g/mol. Its IUPAC name is [1-[5-(3-ethoxy-3-oxo-2-propan-2-yloxypropyl)-2-fluorophenyl]-2-methyl-1-oxoniopropan-2-yl]-dimethylsilanylium.
| Compound Name | [1-[5-(3-ethoxy-3-oxo-2-propan-2-yloxypropyl)-2-fluorophenyl]-2-methyl-1-oxoniopropan-2-yl]-dimethylsilanylium |
|---|---|
| PubChem CID | 152982056 |
| Molecular Formula | C20H35FO4Si+2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | [1-[5-(3-ethoxy-3-oxo-2-propan-2-yloxypropyl)-2-fluorophenyl]-2-methyl-1-oxoniopropan-2-yl]-dimethylsilanylium |
| SMILES | CCOC(=O)C(Cc1ccc(F)c(C([OH2+])C(C)(C)[SiH2+](C)C)c1)OC(C)C |
| InChI | InChI=1S/C20H34FO4Si/c1-8-24-19(23)17(25-13(2)3)12-14-9-10-16(21)15(11-14)18(22)20(4,5)26(6)7/h9-11,13,17-18,22H,8,12,26H2,1-7H3/q+1/p+1 |
| InChIKey | BJFYTRMMRGZQOF-UHFFFAOYSA-O |
| XLogP | 3.49 |
| TPSA | 58.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|