C11H20Y2-2 — CID 153032269
but-1-ene;2,4-dimethylpent-1-ene;bis(yttrium) (PubChem CID 153032269) has the molecular formula C11H20Y2-2 and a molecular weight of 330.09 g/mol. Its IUPAC name is but-1-ene;2,4-dimethylpent-1-ene;bis(yttrium).
| Compound Name | but-1-ene;2,4-dimethylpent-1-ene;bis(yttrium) |
|---|---|
| PubChem CID | 153032269 |
| Molecular Formula | C11H20Y2-2 |
| Molecular Weight | 330.09 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | but-1-ene;2,4-dimethylpent-1-ene;bis(yttrium) |
| SMILES | C=C(C)C[C-](C)C.C=[C-]CC.[Y].[Y] |
| InChI | InChI=1S/C7H13.C4H7.2Y/c1-6(2)5-7(3)4;1-3-4-2;;/h1,5H2,2-4H3;1,4H2,2H3;;/q2*-1;; |
| InChIKey | HELXMGFLRUUFRK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.09 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|