C22H22F3NO3 — CID 153054872
N-[2-(3,3-diethoxyprop-1-ynyl)phenyl]-2,2,2-trifluoro-N-(4-methylphenyl)acetamide (PubChem CID 153054872) has the molecular formula C22H22F3NO3 and a molecular weight of 405.42 g/mol. Its IUPAC name is N-[2-(3,3-diethoxyprop-1-ynyl)phenyl]-2,2,2-trifluoro-N-(4-methylphenyl)acetamide.
| Compound Name | N-[2-(3,3-diethoxyprop-1-ynyl)phenyl]-2,2,2-trifluoro-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 153054872 |
| Molecular Formula | C22H22F3NO3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[2-(3,3-diethoxyprop-1-ynyl)phenyl]-2,2,2-trifluoro-N-(4-methylphenyl)acetamide |
| SMILES | CCOC(C#Cc1ccccc1N(C(=O)C(F)(F)F)c1ccc(C)cc1)OCC |
| InChI | InChI=1S/C22H22F3NO3/c1-4-28-20(29-5-2)15-12-17-8-6-7-9-19(17)26(21(27)22(23,24)25)18-13-10-16(3)11-14-18/h6-11,13-14,20H,4-5H2,1-3H3 |
| InChIKey | VIHAGTOXPVYVNU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|