C7H14N2O2 — CID 15306182
3-hydroxy-2-propan-2-yl-1,3-diazinan-4-one (PubChem CID 15306182) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 3-hydroxy-2-propan-2-yl-1,3-diazinan-4-one.
| Compound Name | 3-hydroxy-2-propan-2-yl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 15306182 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 3-hydroxy-2-propan-2-yl-1,3-diazinan-4-one |
| SMILES | CC(C)C1NCCC(=O)N1O |
| InChI | InChI=1S/C7H14N2O2/c1-5(2)7-8-4-3-6(10)9(7)11/h5,7-8,11H,3-4H2,1-2H3 |
| InChIKey | HOZUSVJKQORWGA-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|