C18H16N2O2 — CID 15306192
3-(anthracen-9-ylmethylideneamino)-N-hydroxypropanamide (PubChem CID 15306192) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-(anthracen-9-ylmethylideneamino)-N-hydroxypropanamide.
| Compound Name | 3-(anthracen-9-ylmethylideneamino)-N-hydroxypropanamide |
|---|---|
| PubChem CID | 15306192 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-(anthracen-9-ylmethylideneamino)-N-hydroxypropanamide |
| SMILES | O=C(CC/N=C/c1c2ccccc2cc2ccccc12)NO |
| InChI | InChI=1S/C18H16N2O2/c21-18(20-22)9-10-19-12-17-15-7-3-1-5-13(15)11-14-6-2-4-8-16(14)17/h1-8,11-12,22H,9-10H2,(H,20,21)/b19-12+ |
| InChIKey | ZEILWFKVWURHQG-XDHOZWIPSA-N |
| XLogP | 3.31 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|