C28H24BrNO2 — CID 148728950
1-(anthracen-9-ylmethylideneamino)-7-(4-bromophenyl)heptane-2,6-dione (PubChem CID 148728950) has the molecular formula C28H24BrNO2 and a molecular weight of 486.41 g/mol. Its IUPAC name is 1-(anthracen-9-ylmethylideneamino)-7-(4-bromophenyl)heptane-2,6-dione.
| Compound Name | 1-(anthracen-9-ylmethylideneamino)-7-(4-bromophenyl)heptane-2,6-dione |
|---|---|
| PubChem CID | 148728950 |
| Molecular Formula | C28H24BrNO2 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 1-(anthracen-9-ylmethylideneamino)-7-(4-bromophenyl)heptane-2,6-dione |
| SMILES | O=C(CCCC(=O)Cc1ccc(Br)cc1)C/N=C/c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C28H24BrNO2/c29-23-14-12-20(13-15-23)16-24(31)8-5-9-25(32)18-30-19-28-26-10-3-1-6-21(26)17-22-7-2-4-11-27(22)28/h1-4,6-7,10-15,17,19H,5,8-9,16,18H2/b30-19+ |
| InChIKey | OAOMXFWPRAZDHE-NDZAJKAJSA-N |
| XLogP | 6.73 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|