C15H21N3O — CID 153085241
N-(oxan-4-yl)-3-propan-2-yl-1H-pyrrolo[3,4-c]pyridin-4-amine (PubChem CID 153085241) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is N-(oxan-4-yl)-3-propan-2-yl-1H-pyrrolo[3,4-c]pyridin-4-amine.
| Compound Name | N-(oxan-4-yl)-3-propan-2-yl-1H-pyrrolo[3,4-c]pyridin-4-amine |
|---|---|
| PubChem CID | 153085241 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-(oxan-4-yl)-3-propan-2-yl-1H-pyrrolo[3,4-c]pyridin-4-amine |
| SMILES | CC(C)C1=NCc2ccnc(NC3CCOCC3)c21 |
| InChI | InChI=1S/C15H21N3O/c1-10(2)14-13-11(9-17-14)3-6-16-15(13)18-12-4-7-19-8-5-12/h3,6,10,12H,4-5,7-9H2,1-2H3,(H,16,18) |
| InChIKey | VOBRUIVWAYHWCN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |