C26H29NO5S — CID 15309478
benzyl (4aS,8aR)-6,7-dimethyl-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate (PubChem CID 15309478) has the molecular formula C26H29NO5S and a molecular weight of 467.59 g/mol. Its IUPAC name is benzyl (4aS,8aR)-6,7-dimethyl-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate.
| Compound Name | benzyl (4aS,8aR)-6,7-dimethyl-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 15309478 |
| Molecular Formula | C26H29NO5S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | benzyl (4aS,8aR)-6,7-dimethyl-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate |
| SMILES | CC1=C(C)C[C@]2(C(=O)OCc3ccccc3)C(=O)N(S(=O)(=O)c3ccc(C)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C26H29NO5S/c1-18-9-11-23(12-10-18)33(30,31)27-14-13-22-15-19(2)20(3)16-26(22,24(27)28)25(29)32-17-21-7-5-4-6-8-21/h4-12,22H,13-17H2,1-3H3/t22-,26-/m1/s1 |
| InChIKey | SDBJXZXOXJEOJG-ATIYNZHBSA-N |
| XLogP | 4.39 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|