C27H27N5O6 — CID 153113817
2-[2-[4-nitro-3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperidin-1-yl]anilino]ethyl]isoindole-1,3-dione (PubChem CID 153113817) has the molecular formula C27H27N5O6 and a molecular weight of 517.54 g/mol. Its IUPAC name is 2-[2-[4-nitro-3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperidin-1-yl]anilino]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-nitro-3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperidin-1-yl]anilino]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 153113817 |
| Molecular Formula | C27H27N5O6 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 2-[2-[4-nitro-3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperidin-1-yl]anilino]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCNc1ccc([N+](=O)[O-])c(N2CCC(C3=CC=C([N+](=O)[O-])CC3)CC2)c1 |
| InChI | InChI=1S/C27H27N5O6/c33-26-22-3-1-2-4-23(22)27(34)30(26)16-13-28-20-7-10-24(32(37)38)25(17-20)29-14-11-19(12-15-29)18-5-8-21(9-6-18)31(35)36/h1-5,7-8,10,17,19,28H,6,9,11-16H2 |
| InChIKey | VTLOFTZEDFHUBX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|