C14H19N2Y- — CID 153129261
6-methyl-4,7-di(propan-2-yl)-2,5-dihydrobenzimidazol-5-ide;yttrium (PubChem CID 153129261) has the molecular formula C14H19N2Y- and a molecular weight of 304.23 g/mol. Its IUPAC name is 6-methyl-4,7-di(propan-2-yl)-2,5-dihydrobenzimidazol-5-ide;yttrium.
| Compound Name | 6-methyl-4,7-di(propan-2-yl)-2,5-dihydrobenzimidazol-5-ide;yttrium |
|---|---|
| PubChem CID | 153129261 |
| Molecular Formula | C14H19N2Y- |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 6-methyl-4,7-di(propan-2-yl)-2,5-dihydrobenzimidazol-5-ide;yttrium |
| SMILES | Cc1[c-]c(C(C)C)c2c(c1C(C)C)=NCN=2.[Y] |
| InChI | InChI=1S/C14H19N2.Y/c1-8(2)11-6-10(5)12(9(3)4)14-13(11)15-7-16-14;/h8-9H,7H2,1-5H3;/q-1; |
| InChIKey | ZBYIXRXAPFUYAJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|