C16H23N2Y2- — CID 149228041
7-(4,4-dimethylpentyl)-4,6-dimethyl-2,5-dihydrobenzimidazol-5-ide;bis(yttrium) (PubChem CID 149228041) has the molecular formula C16H23N2Y2- and a molecular weight of 421.19 g/mol. Its IUPAC name is 7-(4,4-dimethylpentyl)-4,6-dimethyl-2,5-dihydrobenzimidazol-5-ide;bis(yttrium).
| Compound Name | 7-(4,4-dimethylpentyl)-4,6-dimethyl-2,5-dihydrobenzimidazol-5-ide;bis(yttrium) |
|---|---|
| PubChem CID | 149228041 |
| Molecular Formula | C16H23N2Y2- |
| Molecular Weight | 421.19 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | 7-(4,4-dimethylpentyl)-4,6-dimethyl-2,5-dihydrobenzimidazol-5-ide;bis(yttrium) |
| SMILES | Cc1[c-]c(C)c2c(c1CCCC(C)(C)C)=NCN=2.[Y].[Y] |
| InChI | InChI=1S/C16H23N2.2Y/c1-11-9-12(2)14-15(18-10-17-14)13(11)7-6-8-16(3,4)5;;/h6-8,10H2,1-5H3;;/q-1;; |
| InChIKey | AYGVYUWUODVDEG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|