C21H14ClN3O — CID 153130331
2-chloro-4-(8,9-dihydrodibenzofuran-3-yl)-6-phenyl-1,3,5-triazine (PubChem CID 153130331) has the molecular formula C21H14ClN3O and a molecular weight of 359.82 g/mol. Its IUPAC name is 2-chloro-4-(8,9-dihydrodibenzofuran-3-yl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-chloro-4-(8,9-dihydrodibenzofuran-3-yl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 153130331 |
| Molecular Formula | C21H14ClN3O |
| Molecular Weight | 359.82 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-chloro-4-(8,9-dihydrodibenzofuran-3-yl)-6-phenyl-1,3,5-triazine |
| SMILES | Clc1nc(-c2ccccc2)nc(-c2ccc3c4c(oc3c2)C=CCC4)n1 |
| InChI | InChI=1S/C21H14ClN3O/c22-21-24-19(13-6-2-1-3-7-13)23-20(25-21)14-10-11-16-15-8-4-5-9-17(15)26-18(16)12-14/h1-3,5-7,9-12H,4,8H2 |
| InChIKey | VWPLJLHYJFHCBL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.82 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |