C15H20N3OS+ — CID 15313967
4-(4-ethyl-5-phenyl-6H-1,3,4-thiadiazin-4-ium-2-yl)morpholine (PubChem CID 15313967) has the molecular formula C15H20N3OS+ and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-(4-ethyl-5-phenyl-6H-1,3,4-thiadiazin-4-ium-2-yl)morpholine.
| Compound Name | 4-(4-ethyl-5-phenyl-6H-1,3,4-thiadiazin-4-ium-2-yl)morpholine |
|---|---|
| PubChem CID | 15313967 |
| Molecular Formula | C15H20N3OS+ |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-(4-ethyl-5-phenyl-6H-1,3,4-thiadiazin-4-ium-2-yl)morpholine |
| SMILES | CC[N+]1=C(c2ccccc2)CSC(N2CCOCC2)=N1 |
| InChI | InChI=1S/C15H20N3OS/c1-2-18-14(13-6-4-3-5-7-13)12-20-15(16-18)17-8-10-19-11-9-17/h3-7H,2,8-12H2,1H3/q+1 |
| InChIKey | IDCAZYHDHUNRBS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 27.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|