C19H19N3OS — CID 15171041
4-[5-(4-phenylphenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine (PubChem CID 15171041) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 4-[5-(4-phenylphenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine.
| Compound Name | 4-[5-(4-phenylphenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine |
|---|---|
| PubChem CID | 15171041 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 4-[5-(4-phenylphenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine |
| SMILES | c1ccc(-c2ccc(C3=NN=C(N4CCOCC4)SC3)cc2)cc1 |
| InChI | InChI=1S/C19H19N3OS/c1-2-4-15(5-3-1)16-6-8-17(9-7-16)18-14-24-19(21-20-18)22-10-12-23-13-11-22/h1-9H,10-14H2 |
| InChIKey | UXLWQFCTDXTBBB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |