C15H19N3OS — CID 3155981
2,6-dimethyl-4-(5-phenyl-6H-1,3,4-thiadiazin-2-yl)morpholine (PubChem CID 3155981) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 2,6-dimethyl-4-(5-phenyl-6H-1,3,4-thiadiazin-2-yl)morpholine.
| Compound Name | 2,6-dimethyl-4-(5-phenyl-6H-1,3,4-thiadiazin-2-yl)morpholine |
|---|---|
| PubChem CID | 3155981 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2,6-dimethyl-4-(5-phenyl-6H-1,3,4-thiadiazin-2-yl)morpholine |
| SMILES | CC1CN(C2=NN=C(c3ccccc3)CS2)CC(C)O1 |
| InChI | InChI=1S/C15H19N3OS/c1-11-8-18(9-12(2)19-11)15-17-16-14(10-20-15)13-6-4-3-5-7-13/h3-7,11-12H,8-10H2,1-2H3 |
| InChIKey | LHEXNUNGQQVOEY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |