C16H18O — CID 15315080
4,4,5-trimethyl-1-phenylhept-6-en-1-yn-3-one (PubChem CID 15315080) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is 4,4,5-trimethyl-1-phenylhept-6-en-1-yn-3-one.
| Compound Name | 4,4,5-trimethyl-1-phenylhept-6-en-1-yn-3-one |
|---|---|
| PubChem CID | 15315080 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 4,4,5-trimethyl-1-phenylhept-6-en-1-yn-3-one |
| SMILES | C=CC(C)C(C)(C)C(=O)C#Cc1ccccc1 |
| InChI | InChI=1S/C16H18O/c1-5-13(2)16(3,4)15(17)12-11-14-9-7-6-8-10-14/h5-10,13H,1H2,2-4H3 |
| InChIKey | ISLBORNMYHLWJD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|