C31H30FN3O5 — CID 153170229
5-[[5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]pentanoic acid (PubChem CID 153170229) has the molecular formula C31H30FN3O5 and a molecular weight of 543.60 g/mol. Its IUPAC name is 5-[[5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]pentanoic acid.
| Compound Name | 5-[[5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 153170229 |
| Molecular Formula | C31H30FN3O5 |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 5-[[5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]pentanoic acid |
| SMILES | Cc1ccc(F)c(CC(=O)Cc2ccc(Oc3ccnc(-c4cc(C(=O)NCCCCC(=O)O)c[nH]4)c3)cc2)c1 |
| InChI | InChI=1S/C31H30FN3O5/c1-20-5-10-27(32)22(14-20)16-24(36)15-21-6-8-25(9-7-21)40-26-11-13-33-29(18-26)28-17-23(19-35-28)31(39)34-12-3-2-4-30(37)38/h5-11,13-14,17-19,35H,2-4,12,15-16H2,1H3,(H,34,39)(H,37,38) |
| InChIKey | WEBLSOAHENJNLC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|