C30H29FN4O4 — CID 58167909
N-(4-amino-4-oxobutyl)-5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carboxamide (PubChem CID 58167909) has the molecular formula C30H29FN4O4 and a molecular weight of 528.58 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carboxamide.
| Compound Name | N-(4-amino-4-oxobutyl)-5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 58167909 |
| Molecular Formula | C30H29FN4O4 |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carboxamide |
| SMILES | Cc1ccc(F)c(CC(=O)Cc2ccc(Oc3ccnc(-c4cc(C(=O)NCCCC(N)=O)c[nH]4)c3)cc2)c1 |
| InChI | InChI=1S/C30H29FN4O4/c1-19-4-9-26(31)21(13-19)15-23(36)14-20-5-7-24(8-6-20)39-25-10-12-33-28(17-25)27-16-22(18-35-27)30(38)34-11-2-3-29(32)37/h4-10,12-13,16-18,35H,2-3,11,14-15H2,1H3,(H2,32,37)(H,34,38) |
| InChIKey | QSWWXRJPFFUAKL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|